C14H18ClN3O3S — CID 164741270
N-(3-chlorophenyl)-6-sulfamoyl-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 164741270) has the molecular formula C14H18ClN3O3S and a molecular weight of 343.84 g/mol. Its IUPAC name is N-(3-chlorophenyl)-6-sulfamoyl-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | N-(3-chlorophenyl)-6-sulfamoyl-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 164741270 |
| Molecular Formula | C14H18ClN3O3S |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-(3-chlorophenyl)-6-sulfamoyl-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | NS(=O)(=O)N1CCC2(CC1)CC2C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H18ClN3O3S/c15-10-2-1-3-11(8-10)17-13(19)12-9-14(12)4-6-18(7-5-14)22(16,20)21/h1-3,8,12H,4-7,9H2,(H,17,19)(H2,16,20,21) |
| InChIKey | WFXIDPGUUIIISR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |