C31H27N3O3 — CID 164741391
(9Z)-2-phenyl-16-phenylmethoxy-1,13,20-triazatetracyclo[11.7.1.03,8.015,20]henicosa-3,5,7,9,15,18-hexaene-14,17-dione (PubChem CID 164741391) has the molecular formula C31H27N3O3 and a molecular weight of 489.58 g/mol. Its IUPAC name is (9Z)-2-phenyl-16-phenylmethoxy-1,13,20-triazatetracyclo[11.7.1.03,8.015,20]henicosa-3,5,7,9,15,18-hexaene-14,17-dione.
| Compound Name | (9Z)-2-phenyl-16-phenylmethoxy-1,13,20-triazatetracyclo[11.7.1.03,8.015,20]henicosa-3,5,7,9,15,18-hexaene-14,17-dione |
|---|---|
| PubChem CID | 164741391 |
| Molecular Formula | C31H27N3O3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | (9Z)-2-phenyl-16-phenylmethoxy-1,13,20-triazatetracyclo[11.7.1.03,8.015,20]henicosa-3,5,7,9,15,18-hexaene-14,17-dione |
| SMILES | O=C1c2c(OCc3ccccc3)c(=O)ccn2N2CN1CC/C=C/c1ccccc1C2c1ccccc1 |
| InChI | InChI=1S/C31H27N3O3/c35-27-18-20-33-29(30(27)37-21-23-11-3-1-4-12-23)31(36)32-19-10-9-14-24-13-7-8-17-26(24)28(34(33)22-32)25-15-5-2-6-16-25/h1-9,11-18,20,28H,10,19,21-22H2/b14-9+ |
| InChIKey | FVOAFJRFIBLNOB-NTEUORMPSA-N |
| XLogP | 4.99 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |