C33H29N3O4 — CID 164741432
(2R,11E)-2-phenyl-17-phenylmethoxyspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3,5,7,11,16,19-hexaene-13,1'-cyclopropane]-15,18-dione (PubChem CID 164741432) has the molecular formula C33H29N3O4 and a molecular weight of 531.61 g/mol. Its IUPAC name is (2R,11E)-2-phenyl-17-phenylmethoxyspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3,5,7,11,16,19-hexaene-13,1'-cyclopropane]-15,18-dione.
| Compound Name | (2R,11E)-2-phenyl-17-phenylmethoxyspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3,5,7,11,16,19-hexaene-13,1'-cyclopropane]-15,18-dione |
|---|---|
| PubChem CID | 164741432 |
| Molecular Formula | C33H29N3O4 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | (2R,11E)-2-phenyl-17-phenylmethoxyspiro[9-oxa-1,14,21-triazatetracyclo[12.7.1.03,8.016,21]docosa-3,5,7,11,16,19-hexaene-13,1'-cyclopropane]-15,18-dione |
| SMILES | O=C1c2c(OCc3ccccc3)c(=O)ccn2N2CN1C1(/C=C/COc3ccccc3[C@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C33H29N3O4/c37-27-16-20-35-30(31(27)40-22-24-10-3-1-4-11-24)32(38)34-23-36(35)29(25-12-5-2-6-13-25)26-14-7-8-15-28(26)39-21-9-17-33(34)18-19-33/h1-17,20,29H,18-19,21-23H2/b17-9+/t29-/m1/s1 |
| InChIKey | BITKYBHRAPURSR-GUIYRGGQSA-N |
| XLogP | 5.05 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|