C32H24N2OS — CID 164743250
2-[6-(1-phenylethyl)-4-(3-pyridin-2-ylphenyl)-1,3-benzothiazol-2-yl]phenol (PubChem CID 164743250) has the molecular formula C32H24N2OS and a molecular weight of 484.62 g/mol. Its IUPAC name is 2-[6-(1-phenylethyl)-4-(3-pyridin-2-ylphenyl)-1,3-benzothiazol-2-yl]phenol.
| Compound Name | 2-[6-(1-phenylethyl)-4-(3-pyridin-2-ylphenyl)-1,3-benzothiazol-2-yl]phenol |
|---|---|
| PubChem CID | 164743250 |
| Molecular Formula | C32H24N2OS |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 2-[6-(1-phenylethyl)-4-(3-pyridin-2-ylphenyl)-1,3-benzothiazol-2-yl]phenol |
| SMILES | CC(c1ccccc1)c1cc(-c2cccc(-c3ccccn3)c2)c2nc(-c3ccccc3O)sc2c1 |
| InChI | InChI=1S/C32H24N2OS/c1-21(22-10-3-2-4-11-22)25-19-27(23-12-9-13-24(18-23)28-15-7-8-17-33-28)31-30(20-25)36-32(34-31)26-14-5-6-16-29(26)35/h2-21,35H,1H3 |
| InChIKey | PIDYYOCQZZESNF-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |