C23H25F2N7O2 — CID 164743566
4-[5-(4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,3-difluoro-1H-pyrrolo[2,3-b]pyridin-2-one (PubChem CID 164743566) has the molecular formula C23H25F2N7O2 and a molecular weight of 469.50 g/mol. Its IUPAC name is 4-[5-(4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,3-difluoro-1H-pyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 4-[5-(4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,3-difluoro-1H-pyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 164743566 |
| Molecular Formula | C23H25F2N7O2 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 4-[5-(4-amino-3-methyl-2-oxa-8-azaspiro[4.5]decan-8-yl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-yl]-3,3-difluoro-1H-pyrrolo[2,3-b]pyridin-2-one |
| SMILES | CC1C(C2(CCN(CC2)C3=CC(=C(C4=NC=NN34)C5=C6C(=NC=C5)NC(=O)C6(F)F)C)CO1)N |
| InChI | InChI=1S/C23H25F2N7O2/c1-12-9-15(31-7-4-22(5-8-31)10-34-13(2)18(22)26)32-20(28-11-29-32)16(12)14-3-6-27-19-17(14)23(24,25)21(33)30-19/h3,6,9,11,13,18H,4-5,7-8,10,26H2,1-2H3,(H,27,30,33) |
| InChIKey | HZIJDRGQZIJMSF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | 810 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |