C19H21F3N2O4 — CID 164745360
[6-(trifluoromethyl)-2-pyridinyl] 2-[2-(dimethylamino)ethoxy]-6-ethoxybenzoate (PubChem CID 164745360) has the molecular formula C19H21F3N2O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is [6-(trifluoromethyl)-2-pyridinyl] 2-[2-(dimethylamino)ethoxy]-6-ethoxybenzoate.
| Compound Name | [6-(trifluoromethyl)-2-pyridinyl] 2-[2-(dimethylamino)ethoxy]-6-ethoxybenzoate |
|---|---|
| PubChem CID | 164745360 |
| Molecular Formula | C19H21F3N2O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | [6-(trifluoromethyl)-2-pyridinyl] 2-[2-(dimethylamino)ethoxy]-6-ethoxybenzoate |
| SMILES | CCOc1cccc(OCCN(C)C)c1C(=O)Oc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C19H21F3N2O4/c1-4-26-13-7-5-8-14(27-12-11-24(2)3)17(13)18(25)28-16-10-6-9-15(23-16)19(20,21)22/h5-10H,4,11-12H2,1-3H3 |
| InChIKey | NUUBZXIWOQWCGD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |