C29H23N2OP — CID 164745434
3-[4-(4-dimethylphosphorylphenyl)phenyl]benzimidazolo[1,2-a]quinoline (PubChem CID 164745434) has the molecular formula C29H23N2OP and a molecular weight of 446.49 g/mol. Its IUPAC name is 3-[4-(4-dimethylphosphorylphenyl)phenyl]benzimidazolo[1,2-a]quinoline.
| Compound Name | 3-[4-(4-dimethylphosphorylphenyl)phenyl]benzimidazolo[1,2-a]quinoline |
|---|---|
| PubChem CID | 164745434 |
| Molecular Formula | C29H23N2OP |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 3-[4-(4-dimethylphosphorylphenyl)phenyl]benzimidazolo[1,2-a]quinoline |
| SMILES | CP(C)(=O)c1ccc(-c2ccc(-c3ccc4c(ccc5nc6ccccc6n54)c3)cc2)cc1 |
| InChI | InChI=1S/C29H23N2OP/c1-33(2,32)25-15-11-21(12-16-25)20-7-9-22(10-8-20)23-13-17-27-24(19-23)14-18-29-30-26-5-3-4-6-28(26)31(27)29/h3-19H,1-2H3 |
| InChIKey | XIQNWXGILPWCIM-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|