C39H40NO3P — CID 164745628
6-[4-(N-(9,9-dimethylfluoren-2-yl)-4-phenylanilino)phenyl]hexylphosphonic acid (PubChem CID 164745628) has the molecular formula C39H40NO3P and a molecular weight of 601.73 g/mol. Its IUPAC name is 6-[4-(N-(9,9-dimethylfluoren-2-yl)-4-phenylanilino)phenyl]hexylphosphonic acid.
| Compound Name | 6-[4-(N-(9,9-dimethylfluoren-2-yl)-4-phenylanilino)phenyl]hexylphosphonic acid |
|---|---|
| PubChem CID | 164745628 |
| Molecular Formula | C39H40NO3P |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | 6-[4-(N-(9,9-dimethylfluoren-2-yl)-4-phenylanilino)phenyl]hexylphosphonic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(CCCCCCP(=O)(O)O)cc3)c3ccc(-c4ccccc4)cc3)cc21 |
| InChI | InChI=1S/C39H40NO3P/c1-39(2)37-16-10-9-15-35(37)36-26-25-34(28-38(36)39)40(33-23-19-31(20-24-33)30-13-7-5-8-14-30)32-21-17-29(18-22-32)12-6-3-4-11-27-44(41,42)43/h5,7-10,13-26,28H,3-4,6,11-12,27H2,1-2H3,(H2,41,42,43) |
| InChIKey | PYEUZQHDMSSYBK-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|