C11H22N2O4P2 — CID 164745943
1,3-bis(dimethylphosphorylmethyl)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 164745943) has the molecular formula C11H22N2O4P2 and a molecular weight of 308.26 g/mol. Its IUPAC name is 1,3-bis(dimethylphosphorylmethyl)-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1,3-bis(dimethylphosphorylmethyl)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 164745943 |
| Molecular Formula | C11H22N2O4P2 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1,3-bis(dimethylphosphorylmethyl)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(CP(C)(C)=O)C(=O)N1CP(C)(C)=O |
| InChI | InChI=1S/C11H22N2O4P2/c1-11(2)9(14)12(7-18(3,4)16)10(15)13(11)8-19(5,6)17/h7-8H2,1-6H3 |
| InChIKey | RYROGUPOAUVHMP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|