C8H6F4NO4- — CID 164746304
2,2,3,3-tetrafluoro-4-oxo-4-(2-oxopyrrolidin-1-yl)butanoate (PubChem CID 164746304) has the molecular formula C8H6F4NO4- and a molecular weight of 256.13 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-4-oxo-4-(2-oxopyrrolidin-1-yl)butanoate.
| Compound Name | 2,2,3,3-tetrafluoro-4-oxo-4-(2-oxopyrrolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 164746304 |
| Molecular Formula | C8H6F4NO4- |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 2,2,3,3-tetrafluoro-4-oxo-4-(2-oxopyrrolidin-1-yl)butanoate |
| SMILES | O=C1CCCN1C(=O)C(F)(F)C(F)(F)C(=O)[O-] |
| InChI | InChI=1S/C8H7F4NO4/c9-7(10,8(11,12)6(16)17)5(15)13-3-1-2-4(13)14/h1-3H2,(H,16,17)/p-1 |
| InChIKey | DKIGYSLRQPCKPA-UHFFFAOYSA-M |
| XLogP | -0.84 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|