About 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid
3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid (PubChem CID 164746524) has the molecular formula C18H26F2O4
and a molecular weight of 344.40 g/mol. Its IUPAC name is 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid.
Molecular Properties
| Compound Name | 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid |
| PubChem CID | 164746524 |
| Molecular Formula | C18H26F2O4 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid |
| SMILES | CC(C)C(C)(OC(=O)C12CC3CC(CC(C3)C1)C2)C(F)(F)C(=O)O |
| InChI | InChI=1S/C18H26F2O4/c1-10(2)16(3,18(19,20)14(21)22)24-15(23)17-7-11-4-12(8-17)6-13(5-11)9-17/h10-13H,4-9H2,1-3H3,(H,21,22) |
| InChIKey | BJJLYASSAPRPLN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid?
The IUPAC name of 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid (CID 164746524) is 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid.
What is the SMILES notation for 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid?
The canonical SMILES for 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid is CC(C)C(C)(OC(=O)C12CC3CC(CC(C3)C1)C2)C(F)(F)C(=O)O.
What is the InChIKey of 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid?
The InChIKey is BJJLYASSAPRPLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26F2O4/c1-10(2)16(3,18(19,20)14(21)22)24-15(23)17-7-11-4-12(8-17)6-13(5-11)9-17/h10-13H,4-9H2,1-3H3,(H,21,22).
What are the key properties of 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid?
3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid has a molecular weight of 344.40 g/mol, XLogP of 3.88, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(adamantane-1-carbonyloxy)-2,2-difluoro-3,4-dimethylpentanoic acid is sourced from PubChem (CID 164746524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).