C11H3F6I3O4 — CID 164746625
2,2,3,3,4,4-hexafluoro-5-oxo-5-(2,4,6-triiodophenoxy)pentanoic acid (PubChem CID 164746625) has the molecular formula C11H3F6I3O4 and a molecular weight of 693.84 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-5-oxo-5-(2,4,6-triiodophenoxy)pentanoic acid.
| Compound Name | 2,2,3,3,4,4-hexafluoro-5-oxo-5-(2,4,6-triiodophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 164746625 |
| Molecular Formula | C11H3F6I3O4 |
| Molecular Weight | 693.84 g/mol |
| Exact Mass | 693.71 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-5-oxo-5-(2,4,6-triiodophenoxy)pentanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(=O)Oc1c(I)cc(I)cc1I |
| InChI | InChI=1S/C11H3F6I3O4/c12-9(13,7(21)22)11(16,17)10(14,15)8(23)24-6-4(19)1-3(18)2-5(6)20/h1-2H,(H,21,22) |
| InChIKey | GNSYQVLDZJFNNV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.84 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|