About 2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid
2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid (PubChem CID 164746777) has the molecular formula C12H16F2O5
and a molecular weight of 278.25 g/mol. Its IUPAC name is 2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid.
Molecular Properties
| Compound Name | 2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid |
| PubChem CID | 164746777 |
| Molecular Formula | C12H16F2O5 |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid |
| SMILES | CCOC(=O)C=C1CCC(O)(C(F)(F)C(=O)O)CC1 |
| InChI | InChI=1S/C12H16F2O5/c1-2-19-9(15)7-8-3-5-11(18,6-4-8)12(13,14)10(16)17/h7,18H,2-6H2,1H3,(H,16,17)/b8-7- |
| InChIKey | CGLSOQNXSKZBCH-FPLPWBNLSA-N |
| XLogP | 1.50 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid?
The IUPAC name of 2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid (CID 164746777) is 2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid.
What is the SMILES notation for 2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid?
The canonical SMILES for 2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid is CCOC(=O)C=C1CCC(O)(C(F)(F)C(=O)O)CC1.
What is the InChIKey of 2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid?
The InChIKey is CGLSOQNXSKZBCH-FPLPWBNLSA-N. The full InChI is InChI=1S/C12H16F2O5/c1-2-19-9(15)7-8-3-5-11(18,6-4-8)12(13,14)10(16)17/h7,18H,2-6H2,1H3,(H,16,17)/b8-7-.
What are the key properties of 2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid?
2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid has a molecular weight of 278.25 g/mol, XLogP of 1.50, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-ethoxy-2-oxoethylidene)-1-hydroxycyclohexyl]-2,2-difluoroacetic acid is sourced from PubChem (CID 164746777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).