C29H32F3O3S+ — CID 164746933
[4-butoxy-3-(2,2,2-trifluoroethoxycarbonyl)phenyl]-(4-butylphenyl)-phenylsulfanium (PubChem CID 164746933) has the molecular formula C29H32F3O3S+ and a molecular weight of 517.63 g/mol. Its IUPAC name is [4-butoxy-3-(2,2,2-trifluoroethoxycarbonyl)phenyl]-(4-butylphenyl)-phenylsulfanium.
| Compound Name | [4-butoxy-3-(2,2,2-trifluoroethoxycarbonyl)phenyl]-(4-butylphenyl)-phenylsulfanium |
|---|---|
| PubChem CID | 164746933 |
| Molecular Formula | C29H32F3O3S+ |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | [4-butoxy-3-(2,2,2-trifluoroethoxycarbonyl)phenyl]-(4-butylphenyl)-phenylsulfanium |
| SMILES | CCCCOc1ccc([S+](c2ccccc2)c2ccc(CCCC)cc2)cc1C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C29H32F3O3S/c1-3-5-10-22-13-15-24(16-14-22)36(23-11-8-7-9-12-23)25-17-18-27(34-19-6-4-2)26(20-25)28(33)35-21-29(30,31)32/h7-9,11-18,20H,3-6,10,19,21H2,1-2H3/q+1 |
| InChIKey | FCEVTQINCYJBBI-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|