C17H10F8O4 — CID 164747113
2,2-difluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]acetic acid (PubChem CID 164747113) has the molecular formula C17H10F8O4 and a molecular weight of 430.25 g/mol. Its IUPAC name is 2,2-difluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]acetic acid.
| Compound Name | 2,2-difluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 164747113 |
| Molecular Formula | C17H10F8O4 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 2,2-difluoro-2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenoxy]acetic acid |
| SMILES | O=C(O)C(F)(F)Oc1ccc(C(c2ccc(O)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H10F8O4/c18-15(19,13(27)28)29-12-7-3-10(4-8-12)14(16(20,21)22,17(23,24)25)9-1-5-11(26)6-2-9/h1-8,26H,(H,27,28) |
| InChIKey | HHSPTDPFPSGASZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |