C21H14F3O3S+ — CID 164747240
2,2,2-trifluoroethyl 4-phenoxathiin-10-ium-10-ylbenzoate (PubChem CID 164747240) has the molecular formula C21H14F3O3S+ and a molecular weight of 403.40 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 4-phenoxathiin-10-ium-10-ylbenzoate.
| Compound Name | 2,2,2-trifluoroethyl 4-phenoxathiin-10-ium-10-ylbenzoate |
|---|---|
| PubChem CID | 164747240 |
| Molecular Formula | C21H14F3O3S+ |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 2,2,2-trifluoroethyl 4-phenoxathiin-10-ium-10-ylbenzoate |
| SMILES | O=C(OCC(F)(F)F)c1ccc([S+]2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C21H14F3O3S/c22-21(23,24)13-26-20(25)14-9-11-15(12-10-14)28-18-7-3-1-5-16(18)27-17-6-2-4-8-19(17)28/h1-12H,13H2/q+1 |
| InChIKey | PUDFTEYQHKEANO-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|