About diphenyl-(3,4,5-trifluorophenyl)sulfanium
diphenyl-(3,4,5-trifluorophenyl)sulfanium (PubChem CID 164747298) has the molecular formula C18H12F3S+
and a molecular weight of 317.36 g/mol. Its IUPAC name is diphenyl-(3,4,5-trifluorophenyl)sulfanium.
Molecular Properties
| Compound Name | diphenyl-(3,4,5-trifluorophenyl)sulfanium |
| PubChem CID | 164747298 |
| Molecular Formula | C18H12F3S+ |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | diphenyl-(3,4,5-trifluorophenyl)sulfanium |
| SMILES | Fc1cc([S+](c2ccccc2)c2ccccc2)cc(F)c1F |
| InChI | InChI=1S/C18H12F3S/c19-16-11-15(12-17(20)18(16)21)22(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H/q+1 |
| InChIKey | NBLZBLQUYCNDPW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-(3,4,5-trifluorophenyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-(3,4,5-trifluorophenyl)sulfanium?
The IUPAC name of diphenyl-(3,4,5-trifluorophenyl)sulfanium (CID 164747298) is diphenyl-(3,4,5-trifluorophenyl)sulfanium.
What is the SMILES notation for diphenyl-(3,4,5-trifluorophenyl)sulfanium?
The canonical SMILES for diphenyl-(3,4,5-trifluorophenyl)sulfanium is Fc1cc([S+](c2ccccc2)c2ccccc2)cc(F)c1F.
What is the InChIKey of diphenyl-(3,4,5-trifluorophenyl)sulfanium?
The InChIKey is NBLZBLQUYCNDPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F3S/c19-16-11-15(12-17(20)18(16)21)22(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H/q+1.
What are the key properties of diphenyl-(3,4,5-trifluorophenyl)sulfanium?
diphenyl-(3,4,5-trifluorophenyl)sulfanium has a molecular weight of 317.36 g/mol, XLogP of 5.20, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-(3,4,5-trifluorophenyl)sulfanium is sourced from PubChem (CID 164747298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).