C15H10F6NO6- — CID 164747353
5-[2-(N-acetylanilino)-2-oxoethoxy]-2,2,3,3,4,4-hexafluoro-5-oxopentanoate (PubChem CID 164747353) has the molecular formula C15H10F6NO6- and a molecular weight of 414.23 g/mol. Its IUPAC name is 5-[2-(N-acetylanilino)-2-oxoethoxy]-2,2,3,3,4,4-hexafluoro-5-oxopentanoate.
| Compound Name | 5-[2-(N-acetylanilino)-2-oxoethoxy]-2,2,3,3,4,4-hexafluoro-5-oxopentanoate |
|---|---|
| PubChem CID | 164747353 |
| Molecular Formula | C15H10F6NO6- |
| Molecular Weight | 414.23 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 5-[2-(N-acetylanilino)-2-oxoethoxy]-2,2,3,3,4,4-hexafluoro-5-oxopentanoate |
| SMILES | CC(=O)N(C(=O)COC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C15H11F6NO6/c1-8(23)22(9-5-3-2-4-6-9)10(24)7-28-12(27)14(18,19)15(20,21)13(16,17)11(25)26/h2-6H,7H2,1H3,(H,25,26)/p-1 |
| InChIKey | SNLRLMQPHMZSQO-UHFFFAOYSA-M |
| XLogP | 0.77 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|