C14H13F4O4- — CID 164747363
2,2,3,3-tetrafluoro-4-oxo-4-(8-tricyclo[5.2.1.02,6]dec-3-enyloxy)butanoate (PubChem CID 164747363) has the molecular formula C14H13F4O4- and a molecular weight of 321.25 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-4-oxo-4-(8-tricyclo[5.2.1.02,6]dec-3-enyloxy)butanoate.
| Compound Name | 2,2,3,3-tetrafluoro-4-oxo-4-(8-tricyclo[5.2.1.02,6]dec-3-enyloxy)butanoate |
|---|---|
| PubChem CID | 164747363 |
| Molecular Formula | C14H13F4O4- |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2,2,3,3-tetrafluoro-4-oxo-4-(8-tricyclo[5.2.1.02,6]dec-3-enyloxy)butanoate |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(=O)OC1CC2CC1C1CC=CC21 |
| InChI | InChI=1S/C14H14F4O4/c15-13(16,11(19)20)14(17,18)12(21)22-10-5-6-4-9(10)8-3-1-2-7(6)8/h1-2,6-10H,3-5H2,(H,19,20)/p-1 |
| InChIKey | BJQHSRLLUMQPGU-UHFFFAOYSA-M |
| XLogP | 1.15 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|