About 2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid
2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid (PubChem CID 164747438) has the molecular formula C8H10F2O5
and a molecular weight of 224.16 g/mol. Its IUPAC name is 2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid.
Molecular Properties
| Compound Name | 2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid |
| PubChem CID | 164747438 |
| Molecular Formula | C8H10F2O5 |
| Molecular Weight | 224.16 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid |
| SMILES | CC1OC(=O)CC1(C)OC(F)(F)C(=O)O |
| InChI | InChI=1S/C8H10F2O5/c1-4-7(2,3-5(11)14-4)15-8(9,10)6(12)13/h4H,3H2,1-2H3,(H,12,13) |
| InChIKey | JFRFHKLGYNELGU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid?
The IUPAC name of 2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid (CID 164747438) is 2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid.
What is the SMILES notation for 2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid?
The canonical SMILES for 2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid is CC1OC(=O)CC1(C)OC(F)(F)C(=O)O.
What is the InChIKey of 2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid?
The InChIKey is JFRFHKLGYNELGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2O5/c1-4-7(2,3-5(11)14-4)15-8(9,10)6(12)13/h4H,3H2,1-2H3,(H,12,13).
What are the key properties of 2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid?
2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid has a molecular weight of 224.16 g/mol, XLogP of 0.77, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethyl-5-oxooxolan-3-yl)oxy-2,2-difluoroacetic acid is sourced from PubChem (CID 164747438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).