C19H8F6O6 — CID 164747492
5-(9,10-dioxoanthracen-2-yl)oxy-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid (PubChem CID 164747492) has the molecular formula C19H8F6O6 and a molecular weight of 446.26 g/mol. Its IUPAC name is 5-(9,10-dioxoanthracen-2-yl)oxy-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid.
| Compound Name | 5-(9,10-dioxoanthracen-2-yl)oxy-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid |
|---|---|
| PubChem CID | 164747492 |
| Molecular Formula | C19H8F6O6 |
| Molecular Weight | 446.26 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 5-(9,10-dioxoanthracen-2-yl)oxy-2,2,3,3,4,4-hexafluoro-5-oxopentanoic acid |
| SMILES | O=C1c2ccccc2C(=O)c2cc(OC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)O)ccc21 |
| InChI | InChI=1S/C19H8F6O6/c20-17(21,15(28)29)19(24,25)18(22,23)16(30)31-8-5-6-11-12(7-8)14(27)10-4-2-1-3-9(10)13(11)26/h1-7H,(H,28,29) |
| InChIKey | WMANKZGLPIPRIS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|