C33H35IrN3O-2 — CID 164748938
CID 164748938 (PubChem CID 164748938) has the molecular formula C33H35IrN3O-2 and a molecular weight of 681.88 g/mol.
| Compound Name | CID 164748938 |
|---|---|
| PubChem CID | 164748938 |
| Molecular Formula | C33H35IrN3O-2 |
| Molecular Weight | 681.88 g/mol |
| Exact Mass | 682.24 |
| IUPAC Name | — |
| SMILES | CC(=O)/C=C(/C)[N-]C1CCCCC1.Cc1ccc2cnc3c(c2c1)C(C)(C)c1cccc2nc[c-]c-3c12.[Ir] |
| InChI | InChI=1S/C22H17N2.C11H19NO.Ir/c1-13-7-8-14-12-24-21-15-9-10-23-18-6-4-5-17(19(15)18)22(2,3)20(21)16(14)11-13;1-9(8-10(2)13)12-11-6-4-3-5-7-11;/h4-8,10-12H,1-3H3;8,11H,3-7H2,1-2H3,(H,12,13);/q-1;;/p-1 |
| InChIKey | NKGAPXZFFZQYCA-UHFFFAOYSA-M |
| XLogP | 8.38 |
| TPSA | 56.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.88 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|