C57H49N5O — CID 164749872
2-[3-[3-(4-tert-butyl-3,5-dideuterio-2,6-diphenylphenyl)-2H-benzimidazol-1-yl]-5-isocyanophenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole (PubChem CID 164749872) has the molecular formula C57H49N5O and a molecular weight of 822.07 g/mol. Its IUPAC name is 2-[3-[3-(4-tert-butyl-3,5-dideuterio-2,6-diphenylphenyl)-2H-benzimidazol-1-yl]-5-isocyanophenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole.
| Compound Name | 2-[3-[3-(4-tert-butyl-3,5-dideuterio-2,6-diphenylphenyl)-2H-benzimidazol-1-yl]-5-isocyanophenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
|---|---|
| PubChem CID | 164749872 |
| Molecular Formula | C57H49N5O |
| Molecular Weight | 822.07 g/mol |
| Exact Mass | 821.41 |
| IUPAC Name | 2-[3-[3-(4-tert-butyl-3,5-dideuterio-2,6-diphenylphenyl)-2H-benzimidazol-1-yl]-5-isocyanophenoxy]-9-(4-tert-butyl-2-pyridinyl)carbazole |
| SMILES | [2H]c1c(-c2ccccc2)c(N2CN(c3cc([N+]#[C-])cc(Oc4ccc5c6ccccc6n(-c6cc(C(C)(C)C)ccn6)c5c4)c3)c3ccccc32)c(-c2ccccc2)c([2H])c1C(C)(C)C |
| InChI | InChI=1S/C57H49N5O/c1-56(2,3)40-28-29-59-54(32-40)62-50-23-15-14-22-46(50)47-27-26-44(36-53(47)62)63-45-34-42(58-7)33-43(35-45)60-37-61(52-25-17-16-24-51(52)60)55-48(38-18-10-8-11-19-38)30-41(57(4,5)6)31-49(55)39-20-12-9-13-21-39/h8-36H,37H2,1-6H3/i30D,31D |
| InChIKey | IBCAIHGFLMCWRK-HFSWBBRHSA-N |
| XLogP | 15.70 |
| TPSA | 37.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.07 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|