C26H32N6O4 — CID 164750429
tert-butyl N-[5-[[2-[2-(1H-indazol-5-yl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate (PubChem CID 164750429) has the molecular formula C26H32N6O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is tert-butyl N-[5-[[2-[2-(1H-indazol-5-yl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[[2-[2-(1H-indazol-5-yl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 164750429 |
| Molecular Formula | C26H32N6O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | tert-butyl N-[5-[[2-[2-(1H-indazol-5-yl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate |
| SMILES | Cc1cc(NC(=O)C(=O)N2CC(C)CCC2c2ccc3[nH]ncc3c2)cnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H32N6O4/c1-15-6-9-21(17-7-8-20-18(11-17)12-28-31-20)32(14-15)24(34)23(33)29-19-10-16(2)22(27-13-19)30-25(35)36-26(3,4)5/h7-8,10-13,15,21H,6,9,14H2,1-5H3,(H,28,31)(H,29,33)(H,27,30,35) |
| InChIKey | QACQRZPGJYXKJC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|