C21H26N4O4S — CID 164750639
N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,5R)-5-methyl-2-(4-methylsulfonylphenyl)piperidin-1-yl]-2-oxoacetamide (PubChem CID 164750639) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,5R)-5-methyl-2-(4-methylsulfonylphenyl)piperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,5R)-5-methyl-2-(4-methylsulfonylphenyl)piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 164750639 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2S,5R)-5-methyl-2-(4-methylsulfonylphenyl)piperidin-1-yl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)N2C[C@H](C)CC[C@H]2c2ccc(S(C)(=O)=O)cc2)cnc1N |
| InChI | InChI=1S/C21H26N4O4S/c1-13-4-9-18(15-5-7-17(8-6-15)30(3,28)29)25(12-13)21(27)20(26)24-16-10-14(2)19(22)23-11-16/h5-8,10-11,13,18H,4,9,12H2,1-3H3,(H2,22,23)(H,24,26)/t13-,18+/m1/s1 |
| InChIKey | RRHBOCZLKOYWOC-ACJLOTCBSA-N |
| XLogP | 2.31 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|