C20H26F2N4O3 — CID 164750642
5-[[2-[(2S,5R)-2-(4,4-difluorocyclohexyl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide (PubChem CID 164750642) has the molecular formula C20H26F2N4O3 and a molecular weight of 408.45 g/mol. Its IUPAC name is 5-[[2-[(2S,5R)-2-(4,4-difluorocyclohexyl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide.
| Compound Name | 5-[[2-[(2S,5R)-2-(4,4-difluorocyclohexyl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164750642 |
| Molecular Formula | C20H26F2N4O3 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 5-[[2-[(2S,5R)-2-(4,4-difluorocyclohexyl)-5-methylpiperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
| SMILES | C[C@@H]1CC[C@@H](C2CCC(F)(F)CC2)N(C(=O)C(=O)Nc2cncc(C(N)=O)c2)C1 |
| InChI | InChI=1S/C20H26F2N4O3/c1-12-2-3-16(13-4-6-20(21,22)7-5-13)26(11-12)19(29)18(28)25-15-8-14(17(23)27)9-24-10-15/h8-10,12-13,16H,2-7,11H2,1H3,(H2,23,27)(H,25,28)/t12-,16+/m1/s1 |
| InChIKey | LNTOUUQEDQEKTB-WBMJQRKESA-N |
| XLogP | 2.57 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|