C12H12F3N — CID 164750994
(3S)-3-methyl-6-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyridine (PubChem CID 164750994) has the molecular formula C12H12F3N and a molecular weight of 227.23 g/mol. Its IUPAC name is (3S)-3-methyl-6-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyridine.
| Compound Name | (3S)-3-methyl-6-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 164750994 |
| Molecular Formula | C12H12F3N |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (3S)-3-methyl-6-(3,4,5-trifluorophenyl)-2,3,4,5-tetrahydropyridine |
| SMILES | C[C@H]1CCC(c2cc(F)c(F)c(F)c2)=NC1 |
| InChI | InChI=1S/C12H12F3N/c1-7-2-3-11(16-6-7)8-4-9(13)12(15)10(14)5-8/h4-5,7H,2-3,6H2,1H3/t7-/m0/s1 |
| InChIKey | RYLYDLMTHXMDRM-ZETCQYMHSA-N |
| XLogP | 3.32 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|