C16H18F3NO3 — CID 164751114
2,2,2-trifluoroethyl 2-[(2S,6S)-2-methyl-6-phenylpiperidin-1-yl]-2-oxoacetate (PubChem CID 164751114) has the molecular formula C16H18F3NO3 and a molecular weight of 329.32 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(2S,6S)-2-methyl-6-phenylpiperidin-1-yl]-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(2S,6S)-2-methyl-6-phenylpiperidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 164751114 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(2S,6S)-2-methyl-6-phenylpiperidin-1-yl]-2-oxoacetate |
| SMILES | C[C@H]1CCC[C@@H](c2ccccc2)N1C(=O)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C16H18F3NO3/c1-11-6-5-9-13(12-7-3-2-4-8-12)20(11)14(21)15(22)23-10-16(17,18)19/h2-4,7-8,11,13H,5-6,9-10H2,1H3/t11-,13-/m0/s1 |
| InChIKey | XDUOTTPDELKUPQ-AAEUAGOBSA-N |
| XLogP | 3.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|