C22H23N5O3S — CID 164751173
5-[[2-[5-methyl-2-(2-methyl-1,3-benzothiazol-5-yl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide (PubChem CID 164751173) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is 5-[[2-[5-methyl-2-(2-methyl-1,3-benzothiazol-5-yl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide.
| Compound Name | 5-[[2-[5-methyl-2-(2-methyl-1,3-benzothiazol-5-yl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164751173 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 5-[[2-[5-methyl-2-(2-methyl-1,3-benzothiazol-5-yl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
| SMILES | Cc1nc2cc(C3CCC(C)CN3C(=O)C(=O)Nc3cncc(C(N)=O)c3)ccc2s1 |
| InChI | InChI=1S/C22H23N5O3S/c1-12-3-5-18(14-4-6-19-17(8-14)25-13(2)31-19)27(11-12)22(30)21(29)26-16-7-15(20(23)28)9-24-10-16/h4,6-10,12,18H,3,5,11H2,1-2H3,(H2,23,28)(H,26,29) |
| InChIKey | QCHNQUBZUHOAPA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|