C17H20F3NO3 — CID 164751310
2,2,2-trifluoroethyl 2-(2,3-dimethyl-6-phenylpiperidin-1-yl)-2-oxoacetate (PubChem CID 164751310) has the molecular formula C17H20F3NO3 and a molecular weight of 343.35 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-(2,3-dimethyl-6-phenylpiperidin-1-yl)-2-oxoacetate.
| Compound Name | 2,2,2-trifluoroethyl 2-(2,3-dimethyl-6-phenylpiperidin-1-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 164751310 |
| Molecular Formula | C17H20F3NO3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-(2,3-dimethyl-6-phenylpiperidin-1-yl)-2-oxoacetate |
| SMILES | CC1CCC(c2ccccc2)N(C(=O)C(=O)OCC(F)(F)F)C1C |
| InChI | InChI=1S/C17H20F3NO3/c1-11-8-9-14(13-6-4-3-5-7-13)21(12(11)2)15(22)16(23)24-10-17(18,19)20/h3-7,11-12,14H,8-10H2,1-2H3 |
| InChIKey | USWYLENTBVQEJY-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|