C22H35N3 — CID 164751484
2-methyl-9-[4-[(2S,5R)-5-methylpiperidin-2-yl]phenyl]-2,9-diazaspiro[5.5]undecane (PubChem CID 164751484) has the molecular formula C22H35N3 and a molecular weight of 341.54 g/mol. Its IUPAC name is 2-methyl-9-[4-[(2S,5R)-5-methylpiperidin-2-yl]phenyl]-2,9-diazaspiro[5.5]undecane.
| Compound Name | 2-methyl-9-[4-[(2S,5R)-5-methylpiperidin-2-yl]phenyl]-2,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 164751484 |
| Molecular Formula | C22H35N3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | 2-methyl-9-[4-[(2S,5R)-5-methylpiperidin-2-yl]phenyl]-2,9-diazaspiro[5.5]undecane |
| SMILES | C[C@@H]1CC[C@@H](c2ccc(N3CCC4(CCCN(C)C4)CC3)cc2)NC1 |
| InChI | InChI=1S/C22H35N3/c1-18-4-9-21(23-16-18)19-5-7-20(8-6-19)25-14-11-22(12-15-25)10-3-13-24(2)17-22/h5-8,18,21,23H,3-4,9-17H2,1-2H3/t18-,21+/m1/s1 |
| InChIKey | RTUJOHCBQFSPBR-NQIIRXRSSA-N |
| XLogP | 4.06 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|