C25H32F2N5O4+ — CID 164751566
tert-butyl N-[5-[[2-[(2S,5S)-4,4-difluoro-5-methyl-2-(1-methylpyridin-1-ium-4-yl)piperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate (PubChem CID 164751566) has the molecular formula C25H32F2N5O4+ and a molecular weight of 504.56 g/mol. Its IUPAC name is tert-butyl N-[5-[[2-[(2S,5S)-4,4-difluoro-5-methyl-2-(1-methylpyridin-1-ium-4-yl)piperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-[[2-[(2S,5S)-4,4-difluoro-5-methyl-2-(1-methylpyridin-1-ium-4-yl)piperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 164751566 |
| Molecular Formula | C25H32F2N5O4+ |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | tert-butyl N-[5-[[2-[(2S,5S)-4,4-difluoro-5-methyl-2-(1-methylpyridin-1-ium-4-yl)piperidin-1-yl]-2-oxoacetyl]amino]-3-methyl-2-pyridinyl]carbamate |
| SMILES | Cc1cc(NC(=O)C(=O)N2C[C@H](C)C(F)(F)C[C@H]2c2cc[n+](C)cc2)cnc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H31F2N5O4/c1-15-11-18(13-28-20(15)30-23(35)36-24(3,4)5)29-21(33)22(34)32-14-16(2)25(26,27)12-19(32)17-7-9-31(6)10-8-17/h7-11,13,16,19H,12,14H2,1-6H3,(H-,28,29,30,33,34,35)/p+1/t16-,19-/m0/s1 |
| InChIKey | OFLXDJCLAUVQKX-LPHOPBHVSA-O |
| XLogP | 3.75 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|