About 5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole
5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole (PubChem CID 164751754) has the molecular formula C11H15N3S
and a molecular weight of 221.33 g/mol. Its IUPAC name is 5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole.
Molecular Properties
| Compound Name | 5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole |
| PubChem CID | 164751754 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole |
| SMILES | CC1CCC(c2cc3[nH]ncc3s2)NC1 |
| InChI | InChI=1S/C11H15N3S/c1-7-2-3-8(12-5-7)10-4-9-11(15-10)6-13-14-9/h4,6-8,12H,2-3,5H2,1H3,(H,13,14) |
| InChIKey | UMTNBPKSVIEFEF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole?
The IUPAC name of 5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole (CID 164751754) is 5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole.
What is the SMILES notation for 5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole?
The canonical SMILES for 5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole is CC1CCC(c2cc3[nH]ncc3s2)NC1.
What is the InChIKey of 5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole?
The InChIKey is UMTNBPKSVIEFEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3S/c1-7-2-3-8(12-5-7)10-4-9-11(15-10)6-13-14-9/h4,6-8,12H,2-3,5H2,1H3,(H,13,14).
What are the key properties of 5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole?
5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole has a molecular weight of 221.33 g/mol, XLogP of 2.68, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-methylpiperidin-2-yl)-1H-thieno[2,3-d]pyrazole is sourced from PubChem (CID 164751754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).