C20H23FN4O2 — CID 164751789
N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,5S)-2-(4-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 164751789) has the molecular formula C20H23FN4O2 and a molecular weight of 370.43 g/mol. Its IUPAC name is N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,5S)-2-(4-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,5S)-2-(4-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 164751789 |
| Molecular Formula | C20H23FN4O2 |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,5S)-2-(4-fluorophenyl)-5-methylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)N2C[C@@H](C)CC[C@@H]2c2ccc(F)cc2)cnc1N |
| InChI | InChI=1S/C20H23FN4O2/c1-12-3-8-17(14-4-6-15(21)7-5-14)25(11-12)20(27)19(26)24-16-9-13(2)18(22)23-10-16/h4-7,9-10,12,17H,3,8,11H2,1-2H3,(H2,22,23)(H,24,26)/t12-,17+/m0/s1 |
| InChIKey | KYAJWWVGEYDQGW-YVEFUNNKSA-N |
| XLogP | 3.05 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|