C20H24N4O2 — CID 164752180
2-[(2R,5S)-2-(4-aminophenyl)-5-methylpiperidin-1-yl]-N-(5-methyl-3-pyridinyl)-2-oxoacetamide (PubChem CID 164752180) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[(2R,5S)-2-(4-aminophenyl)-5-methylpiperidin-1-yl]-N-(5-methyl-3-pyridinyl)-2-oxoacetamide.
| Compound Name | 2-[(2R,5S)-2-(4-aminophenyl)-5-methylpiperidin-1-yl]-N-(5-methyl-3-pyridinyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 164752180 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-[(2R,5S)-2-(4-aminophenyl)-5-methylpiperidin-1-yl]-N-(5-methyl-3-pyridinyl)-2-oxoacetamide |
| SMILES | Cc1cncc(NC(=O)C(=O)N2C[C@@H](C)CC[C@@H]2c2ccc(N)cc2)c1 |
| InChI | InChI=1S/C20H24N4O2/c1-13-3-8-18(15-4-6-16(21)7-5-15)24(12-13)20(26)19(25)23-17-9-14(2)10-22-11-17/h4-7,9-11,13,18H,3,8,12,21H2,1-2H3,(H,23,25)/t13-,18+/m0/s1 |
| InChIKey | IZIABRNMNCAQJI-SCLBCKFNSA-N |
| XLogP | 2.91 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|