C22H24N6O3 — CID 164752513
5-[[2-[(2S,5R)-5-methyl-2-(1-methylindazol-6-yl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide (PubChem CID 164752513) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 5-[[2-[(2S,5R)-5-methyl-2-(1-methylindazol-6-yl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide.
| Compound Name | 5-[[2-[(2S,5R)-5-methyl-2-(1-methylindazol-6-yl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 164752513 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 5-[[2-[(2S,5R)-5-methyl-2-(1-methylindazol-6-yl)piperidin-1-yl]-2-oxoacetyl]amino]pyridine-3-carboxamide |
| SMILES | C[C@@H]1CC[C@@H](c2ccc3cnn(C)c3c2)N(C(=O)C(=O)Nc2cncc(C(N)=O)c2)C1 |
| InChI | InChI=1S/C22H24N6O3/c1-13-3-6-18(14-4-5-15-10-25-27(2)19(15)8-14)28(12-13)22(31)21(30)26-17-7-16(20(23)29)9-24-11-17/h4-5,7-11,13,18H,3,6,12H2,1-2H3,(H2,23,29)(H,26,30)/t13-,18+/m1/s1 |
| InChIKey | SWFWTGJNQURQAC-ACJLOTCBSA-N |
| XLogP | 2.01 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|