C21H24F2N4O2 — CID 164752642
N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,5S)-2-[4-(difluoromethyl)phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide (PubChem CID 164752642) has the molecular formula C21H24F2N4O2 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,5S)-2-[4-(difluoromethyl)phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,5S)-2-[4-(difluoromethyl)phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 164752642 |
| Molecular Formula | C21H24F2N4O2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-(6-amino-5-methyl-3-pyridinyl)-2-[(2R,5S)-2-[4-(difluoromethyl)phenyl]-5-methylpiperidin-1-yl]-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)N2C[C@@H](C)CC[C@@H]2c2ccc(C(F)F)cc2)cnc1N |
| InChI | InChI=1S/C21H24F2N4O2/c1-12-3-8-17(14-4-6-15(7-5-14)18(22)23)27(11-12)21(29)20(28)26-16-9-13(2)19(24)25-10-16/h4-7,9-10,12,17-18H,3,8,11H2,1-2H3,(H2,24,25)(H,26,28)/t12-,17+/m0/s1 |
| InChIKey | FBWSLJYZSXAWOS-YVEFUNNKSA-N |
| XLogP | 3.85 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|