C28H38N6O3 — CID 164753126
N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2R,5S)-5-methyl-2-[4-(2-methyl-5-oxa-2,8-diazaspiro[3.5]nonan-8-yl)phenyl]piperidin-1-yl]-2-oxoacetamide (PubChem CID 164753126) has the molecular formula C28H38N6O3 and a molecular weight of 506.65 g/mol. Its IUPAC name is N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2R,5S)-5-methyl-2-[4-(2-methyl-5-oxa-2,8-diazaspiro[3.5]nonan-8-yl)phenyl]piperidin-1-yl]-2-oxoacetamide.
| Compound Name | N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2R,5S)-5-methyl-2-[4-(2-methyl-5-oxa-2,8-diazaspiro[3.5]nonan-8-yl)phenyl]piperidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 164753126 |
| Molecular Formula | C28H38N6O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | N-(6-amino-5-ethyl-3-pyridinyl)-2-[(2R,5S)-5-methyl-2-[4-(2-methyl-5-oxa-2,8-diazaspiro[3.5]nonan-8-yl)phenyl]piperidin-1-yl]-2-oxoacetamide |
| SMILES | CCc1cc(NC(=O)C(=O)N2C[C@@H](C)CC[C@@H]2c2ccc(N3CCOC4(CN(C)C4)C3)cc2)cnc1N |
| InChI | InChI=1S/C28H38N6O3/c1-4-20-13-22(14-30-25(20)29)31-26(35)27(36)34-15-19(2)5-10-24(34)21-6-8-23(9-7-21)33-11-12-37-28(18-33)16-32(3)17-28/h6-9,13-14,19,24H,4-5,10-12,15-18H2,1-3H3,(H2,29,30)(H,31,35)/t19-,24+/m0/s1 |
| InChIKey | WTHQTNGTKPIWBR-YADARESESA-N |
| XLogP | 2.69 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|