C23H34N4 — CID 164753147
5-(3-methyl-1,2,3,4-tetrahydropyridin-6-yl)-2-(1,2,2,6,6-pentamethylpiperidin-4-yl)indazole (PubChem CID 164753147) has the molecular formula C23H34N4 and a molecular weight of 366.55 g/mol. Its IUPAC name is 5-(3-methyl-1,2,3,4-tetrahydropyridin-6-yl)-2-(1,2,2,6,6-pentamethylpiperidin-4-yl)indazole.
| Compound Name | 5-(3-methyl-1,2,3,4-tetrahydropyridin-6-yl)-2-(1,2,2,6,6-pentamethylpiperidin-4-yl)indazole |
|---|---|
| PubChem CID | 164753147 |
| Molecular Formula | C23H34N4 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 5-(3-methyl-1,2,3,4-tetrahydropyridin-6-yl)-2-(1,2,2,6,6-pentamethylpiperidin-4-yl)indazole |
| SMILES | CC1CC=C(c2ccc3nn(C4CC(C)(C)N(C)C(C)(C)C4)cc3c2)NC1 |
| InChI | InChI=1S/C23H34N4/c1-16-7-9-20(24-14-16)17-8-10-21-18(11-17)15-27(25-21)19-12-22(2,3)26(6)23(4,5)13-19/h8-11,15-16,19,24H,7,12-14H2,1-6H3 |
| InChIKey | OKYFMFTXBBYVKL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |