C20H29N3O — CID 164753272
2-(1-methylpiperidin-4-yl)-6-[(5S)-5-methylpiperidin-2-yl]-3H-isoindol-1-one (PubChem CID 164753272) has the molecular formula C20H29N3O and a molecular weight of 327.47 g/mol. Its IUPAC name is 2-(1-methylpiperidin-4-yl)-6-[(5S)-5-methylpiperidin-2-yl]-3H-isoindol-1-one.
| Compound Name | 2-(1-methylpiperidin-4-yl)-6-[(5S)-5-methylpiperidin-2-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 164753272 |
| Molecular Formula | C20H29N3O |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 2-(1-methylpiperidin-4-yl)-6-[(5S)-5-methylpiperidin-2-yl]-3H-isoindol-1-one |
| SMILES | C[C@H]1CCC(c2ccc3c(c2)C(=O)N(C2CCN(C)CC2)C3)NC1 |
| InChI | InChI=1S/C20H29N3O/c1-14-3-6-19(21-12-14)15-4-5-16-13-23(20(24)18(16)11-15)17-7-9-22(2)10-8-17/h4-5,11,14,17,19,21H,3,6-10,12-13H2,1-2H3/t14-,19?/m0/s1 |
| InChIKey | AGFKCQCYPCHCHU-KTQQKIMGSA-N |
| XLogP | 2.80 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |