C20H29N3O2Si — CID 164753329
6-(3-methyl-1,2,3,4-tetrahydropyridin-6-yl)-1-(2-trimethylsilylethoxymethyl)-1,5-naphthyridin-2-one (PubChem CID 164753329) has the molecular formula C20H29N3O2Si and a molecular weight of 371.56 g/mol. Its IUPAC name is 6-(3-methyl-1,2,3,4-tetrahydropyridin-6-yl)-1-(2-trimethylsilylethoxymethyl)-1,5-naphthyridin-2-one.
| Compound Name | 6-(3-methyl-1,2,3,4-tetrahydropyridin-6-yl)-1-(2-trimethylsilylethoxymethyl)-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 164753329 |
| Molecular Formula | C20H29N3O2Si |
| Molecular Weight | 371.56 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 6-(3-methyl-1,2,3,4-tetrahydropyridin-6-yl)-1-(2-trimethylsilylethoxymethyl)-1,5-naphthyridin-2-one |
| SMILES | CC1CC=C(c2ccc3c(ccc(=O)n3COCC[Si](C)(C)C)n2)NC1 |
| InChI | InChI=1S/C20H29N3O2Si/c1-15-5-6-16(21-13-15)17-7-9-19-18(22-17)8-10-20(24)23(19)14-25-11-12-26(2,3)4/h6-10,15,21H,5,11-14H2,1-4H3 |
| InChIKey | KMJMIHSDGLFWQJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|