About 4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene
4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene (PubChem CID 164754123) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is 4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene.
Molecular Properties
| Compound Name | 4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene |
| PubChem CID | 164754123 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene |
| SMILES | [C-]#[N+]CC(CC=C)(CC=C)CC=C |
| InChI | InChI=1S/C12H17N/c1-5-8-12(9-6-2,10-7-3)11-13-4/h5-7H,1-3,8-11H2 |
| InChIKey | YOCVZCRGQZFXBV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene?
The IUPAC name of 4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene (CID 164754123) is 4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene.
What is the SMILES notation for 4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene?
The canonical SMILES for 4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene is [C-]#[N+]CC(CC=C)(CC=C)CC=C.
What is the InChIKey of 4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene?
The InChIKey is YOCVZCRGQZFXBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-5-8-12(9-6-2,10-7-3)11-13-4/h5-7H,1-3,8-11H2.
What are the key properties of 4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene?
4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene has a molecular weight of 175.27 g/mol, XLogP of 3.62, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(isocyanomethyl)-4-prop-2-enylhepta-1,6-diene is sourced from PubChem (CID 164754123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).