C35H31F2N5O3 — CID 164754360
(1R,3S,6S)-6-benzyl-7-(4,6-difluoro-1H-indole-2-carbonyl)-5,18-dioxo-4,7,17-triazatetracyclo[11.5.2.11,4.016,19]henicosa-13(20),14,16(19)-triene-3-carbonitrile (PubChem CID 164754360) has the molecular formula C35H31F2N5O3 and a molecular weight of 607.66 g/mol. Its IUPAC name is (1R,3S,6S)-6-benzyl-7-(4,6-difluoro-1H-indole-2-carbonyl)-5,18-dioxo-4,7,17-triazatetracyclo[11.5.2.11,4.016,19]henicosa-13(20),14,16(19)-triene-3-carbonitrile.
| Compound Name | (1R,3S,6S)-6-benzyl-7-(4,6-difluoro-1H-indole-2-carbonyl)-5,18-dioxo-4,7,17-triazatetracyclo[11.5.2.11,4.016,19]henicosa-13(20),14,16(19)-triene-3-carbonitrile |
|---|---|
| PubChem CID | 164754360 |
| Molecular Formula | C35H31F2N5O3 |
| Molecular Weight | 607.66 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | (1R,3S,6S)-6-benzyl-7-(4,6-difluoro-1H-indole-2-carbonyl)-5,18-dioxo-4,7,17-triazatetracyclo[11.5.2.11,4.016,19]henicosa-13(20),14,16(19)-triene-3-carbonitrile |
| SMILES | N#C[C@@H]1C[C@]23CN1C(=O)[C@H](Cc1ccccc1)N(C(=O)c1cc4c(F)cc(F)cc4[nH]1)CCCCCc1ccc(c2c1)NC3=O |
| InChI | InChI=1S/C35H31F2N5O3/c36-23-15-27(37)25-17-30(39-29(25)16-23)32(43)41-12-6-2-5-9-22-10-11-28-26(13-22)35(34(45)40-28)18-24(19-38)42(20-35)33(44)31(41)14-21-7-3-1-4-8-21/h1,3-4,7-8,10-11,13,15-17,24,31,39H,2,5-6,9,12,14,18,20H2,(H,40,45)/t24-,31-,35-/m0/s1 |
| InChIKey | XJFCWZZPSQIIJL-MGEYMVMTSA-N |
| XLogP | 5.24 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.66 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |