C20H36ClN3O — CID 164754422
4-(4-chlorocyclohexyl)-N-[(4-methyloxolan-2-yl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydrophthalazin-1-amine (PubChem CID 164754422) has the molecular formula C20H36ClN3O and a molecular weight of 369.98 g/mol. Its IUPAC name is 4-(4-chlorocyclohexyl)-N-[(4-methyloxolan-2-yl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydrophthalazin-1-amine.
| Compound Name | 4-(4-chlorocyclohexyl)-N-[(4-methyloxolan-2-yl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydrophthalazin-1-amine |
|---|---|
| PubChem CID | 164754422 |
| Molecular Formula | C20H36ClN3O |
| Molecular Weight | 369.98 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 4-(4-chlorocyclohexyl)-N-[(4-methyloxolan-2-yl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydrophthalazin-1-amine |
| SMILES | CC1COC(CNC2NNC(C3CCC(Cl)CC3)C3CCCCC23)C1 |
| InChI | InChI=1S/C20H36ClN3O/c1-13-10-16(25-12-13)11-22-20-18-5-3-2-4-17(18)19(23-24-20)14-6-8-15(21)9-7-14/h13-20,22-24H,2-12H2,1H3 |
| InChIKey | KVTWEWVPQHGLLS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.98 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|