C23H32N4O3 — CID 164754517
N-[(3,4-dimethoxyphenyl)-(2-piperidin-4-ylethylamino)-pyridin-4-ylmethyl]acetamide (PubChem CID 164754517) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)-(2-piperidin-4-ylethylamino)-pyridin-4-ylmethyl]acetamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)-(2-piperidin-4-ylethylamino)-pyridin-4-ylmethyl]acetamide |
|---|---|
| PubChem CID | 164754517 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)-(2-piperidin-4-ylethylamino)-pyridin-4-ylmethyl]acetamide |
| SMILES | COc1ccc(C(NCCC2CCNCC2)(NC(C)=O)c2ccncc2)cc1OC |
| InChI | InChI=1S/C23H32N4O3/c1-17(28)27-23(19-9-13-25-14-10-19,26-15-8-18-6-11-24-12-7-18)20-4-5-21(29-2)22(16-20)30-3/h4-5,9-10,13-14,16,18,24,26H,6-8,11-12,15H2,1-3H3,(H,27,28) |
| InChIKey | UKTCTAMJFPIGTE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|