C14H21BF2N4O2 — CID 164754572
N'-[4-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 164754572) has the molecular formula C14H21BF2N4O2 and a molecular weight of 326.16 g/mol. Its IUPAC name is N'-[4-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 164754572 |
| Molecular Formula | C14H21BF2N4O2 |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N'-[4-(difluoromethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1ncc(B2OC(C)(C)C(C)(C)O2)c(C(F)F)n1 |
| InChI | InChI=1S/C14H21BF2N4O2/c1-13(2)14(3,4)23-15(22-13)9-7-18-12(19-8-21(5)6)20-10(9)11(16)17/h7-8,11H,1-6H3/b19-8+ |
| InChIKey | MWYGGNJYCIYIBQ-UFWORHAWSA-N |
| XLogP | 1.93 |
| TPSA | 59.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|