C28H28N2O4 — CID 164756415
trans-methyl (1R,2R)-2-[[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]methyl]-1-(4-phenylphenyl)cyclopropane-1-carboxylate (PubChem CID 164756415) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is trans-methyl (1R,2R)-2-[[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]methyl]-1-(4-phenylphenyl)cyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1R,2R)-2-[[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]methyl]-1-(4-phenylphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 164756415 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | trans-methyl (1R,2R)-2-[[[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]methylamino]methyl]-1-(4-phenylphenyl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccc(-c3ccccc3)cc2)C[C@H]1CNCc1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C28H28N2O4/c1-34-27(32)28(24-14-12-23(13-15-24)22-5-3-2-4-6-22)17-25(28)19-29-18-21-9-7-20(8-10-21)11-16-26(31)30-33/h2-16,25,29,33H,17-19H2,1H3,(H,30,31)/b16-11+/t25-,28-/m0/s1 |
| InChIKey | UJUPGSBLLKIHOH-SVPZBZDHSA-N |
| XLogP | 4.09 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|