C56H42N2Si — CID 164756570
2-[3-(2,6-diphenylphenyl)carbazol-9-yl]-10,10-dimethyl-5-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzo[b][1,4]benzazasiline (PubChem CID 164756570) has the molecular formula C56H42N2Si and a molecular weight of 776.08 g/mol. Its IUPAC name is 2-[3-(2,6-diphenylphenyl)carbazol-9-yl]-10,10-dimethyl-5-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzo[b][1,4]benzazasiline.
| Compound Name | 2-[3-(2,6-diphenylphenyl)carbazol-9-yl]-10,10-dimethyl-5-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzo[b][1,4]benzazasiline |
|---|---|
| PubChem CID | 164756570 |
| Molecular Formula | C56H42N2Si |
| Molecular Weight | 776.08 g/mol |
| Exact Mass | 775.34 |
| IUPAC Name | 2-[3-(2,6-diphenylphenyl)carbazol-9-yl]-10,10-dimethyl-5-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]benzo[b][1,4]benzazasiline |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(N3c4ccccc4[Si](C)(C)c4cc(-n5c6ccccc6c6cc(-c7c(-c8ccccc8)cccc7-c7ccccc7)ccc65)ccc43)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C56H42N2Si/c1-59(2)54-31-15-14-30-52(54)58(44-25-16-24-42(36-44)39-18-6-3-7-19-39)53-35-33-45(38-55(53)59)57-50-29-13-12-26-48(50)49-37-43(32-34-51(49)57)56-46(40-20-8-4-9-21-40)27-17-28-47(56)41-22-10-5-11-23-41/h3-38H,1-2H3/i3D,6D,7D,18D,19D |
| InChIKey | YYMRUNKNELIZLK-NDEWOLMUSA-N |
| XLogP | 14.06 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.08 |
| LogP ≤ 5 | 14.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|