C54H38N2Si — CID 164756587
[9-[9-(2,3,4,5,6-pentadeuteriophenyl)carbazol-3-yl]carbazol-2-yl]-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-diphenylsilane (PubChem CID 164756587) has the molecular formula C54H38N2Si and a molecular weight of 753.06 g/mol. Its IUPAC name is [9-[9-(2,3,4,5,6-pentadeuteriophenyl)carbazol-3-yl]carbazol-2-yl]-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-diphenylsilane.
| Compound Name | [9-[9-(2,3,4,5,6-pentadeuteriophenyl)carbazol-3-yl]carbazol-2-yl]-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-diphenylsilane |
|---|---|
| PubChem CID | 164756587 |
| Molecular Formula | C54H38N2Si |
| Molecular Weight | 753.06 g/mol |
| Exact Mass | 752.34 |
| IUPAC Name | [9-[9-(2,3,4,5,6-pentadeuteriophenyl)carbazol-3-yl]carbazol-2-yl]-[3-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-diphenylsilane |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc([Si](c3ccccc3)(c3ccccc3)c3ccc4c5ccccc5n(-c5ccc6c(c5)c5ccccc5n6-c5c([2H])c([2H])c([2H])c([2H])c5[2H])c4c3)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C54H38N2Si/c1-5-18-39(19-6-1)40-20-17-27-45(36-40)57(43-23-9-3-10-24-43,44-25-11-4-12-26-44)46-33-34-49-47-28-13-15-30-51(47)56(54(49)38-46)42-32-35-53-50(37-42)48-29-14-16-31-52(48)55(53)41-21-7-2-8-22-41/h1-38H/i1D,2D,5D,6D,7D,8D,18D,19D,21D,22D |
| InChIKey | IBRBJGLLGPVZRR-RPJFABSQSA-N |
| XLogP | 10.93 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.06 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|