C64H48N2 — CID 164756663
9,9-dimethyl-10-(2,3,4,5,6-pentadeuteriophenyl)-2-[2-[phenyl-bis(3-phenylphenyl)methyl]carbazol-9-yl]acridine (PubChem CID 164756663) has the molecular formula C64H48N2 and a molecular weight of 850.13 g/mol. Its IUPAC name is 9,9-dimethyl-10-(2,3,4,5,6-pentadeuteriophenyl)-2-[2-[phenyl-bis(3-phenylphenyl)methyl]carbazol-9-yl]acridine.
| Compound Name | 9,9-dimethyl-10-(2,3,4,5,6-pentadeuteriophenyl)-2-[2-[phenyl-bis(3-phenylphenyl)methyl]carbazol-9-yl]acridine |
|---|---|
| PubChem CID | 164756663 |
| Molecular Formula | C64H48N2 |
| Molecular Weight | 850.13 g/mol |
| Exact Mass | 849.41 |
| IUPAC Name | 9,9-dimethyl-10-(2,3,4,5,6-pentadeuteriophenyl)-2-[2-[phenyl-bis(3-phenylphenyl)methyl]carbazol-9-yl]acridine |
| SMILES | [2H]c1c([2H])c([2H])c(N2c3ccccc3C(C)(C)c3cc(-n4c5ccccc5c5ccc(C(c6ccccc6)(c6cccc(-c7ccccc7)c6)c6cccc(-c7ccccc7)c6)cc54)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C64H48N2/c1-63(2)57-34-16-18-36-60(57)65(53-31-13-6-14-32-53)61-40-38-54(44-58(61)63)66-59-35-17-15-33-55(59)56-39-37-52(43-62(56)66)64(49-27-11-5-12-28-49,50-29-19-25-47(41-50)45-21-7-3-8-22-45)51-30-20-26-48(42-51)46-23-9-4-10-24-46/h3-44H,1-2H3/i6D,13D,14D,31D,32D |
| InChIKey | QGMPKVBBFZFZLE-NULKVFNPSA-N |
| XLogP | 16.61 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.13 |
| LogP ≤ 5 | 16.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|